library_table
1,565,620 rows
This data as json, CSV (advanced)
| Link | rowid ▼ | scan | spectrum_id | collision_energy | Adduct | Compound_Source | Compound_Name | Precursor_MZ | ExactMass | Charge | Ion_Mode | Smiles | INCHI | InChIKey_smiles | msManufacturer | msMassAnalyzer | msIonisation | msDissociationMethod | GNPS_library_membership | ppmBetweenExpAndThMass | classyfire_kingdom | classyfire_superclass | classyfire_class | classyfire_subclass | classyfire_direct_parent | np_classifier_nplikeness | falcon_cluster | spectrum_id_int | representative_spectrum_int | InChIKey_smiles_firstBlock | fp_pattern | fp_popcnt | fp_morgan | fp_morgan_popcnt |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1 | 1 | 1 | CCMSLIB00000001547 | [M+H]1+ | isolated | 3-Des-Microcystein_LR | 981.54 | 980.533117744 | 1 | positive | CC(C=CC1NC(=O)C(CCCN=C(N)N)NC(=O)C(C)C(C(=O)O)NC(=O)C(CC(C)C)=NC(=O)C(C)NC(=O)C(C)N(C)C(=O)CCC(C(=O)O)NC(=O)C1C)=CC(C)C(O)Cc1ccccc1 | InChI=1S/C48H72N10O12/c1-25(2)22-36-45(66)57-39(47(69)70)29(6)41(62)54-34(16-13-21-51-48(49)50)44(65)53-33(18-17-26(3)23-27(4)37(59)24-32-14-11-10-12-15-32)28(5)40(61)55-35(46(67)68)19-20-38(60)58(9)31(8)43(64)52-30(7)42(63)56-36/h10-12,14-15,17-18,23,25,27-31,33-35,37,39,59H,13,16,19-22,24H2,1-9H3,(H,52,64)(H,53,65)(H,54,62)(H,55,61)(H,57,66)(H,67,68)(H,69,70)(H4,49,50,51) | UYJGHPVHCMVZPP-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.4062627484887423 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Oligopeptides | 0.97 | 456810 | 1 | 1 | UYJGHPVHCMVZPP | <Binary: 256 bytes> | 727 | <Binary: 256 bytes> | 99 | |||
| 2 | 2 | 2 | CCMSLIB00000001548 | [M+H]1+ | isolated | Hoiamide B | 940.25 | 939.451956536 | 1 | positive | CCCC(C)C(O)C(C)C1OC(=O)C(C(C)O)NC(=O)C(C(C)CC)OC(=O)C(C)C(O)C(C(C)CC)NC(=O)C2(C)CSC(=N2)C2(C)CSC(=N2)c2csc(n2)CC(OC)C1C | InChI=1S/C45H73N5O10S3/c1-14-17-24(6)34(52)26(8)37-25(7)30(58-13)18-31-46-29(19-61-31)39-49-45(12,21-62-39)43-50-44(11,20-63-43)42(57)48-32(22(4)15-2)35(53)27(9)40(55)59-36(23(5)16-3)38(54)47-33(28(10)51)41(56)60-37/h19,22-28,30,32-37,51-53H,14-18,20-21H2,1-13H3,(H,47,54)(H,48,57) | KNGPFNUOXXLKCN-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 222.4836459813232 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.43 | 453410 | 2 | 2 | KNGPFNUOXXLKCN | <Binary: 256 bytes> | 901 | <Binary: 256 bytes> | 96 | |||
| 3 | 3 | 3 | CCMSLIB00000001549 | [M+H]1+ | isolated | Malyngamide C | 456.1 | 455.2438509959999 | 1 | positive | CCCCCCCC(CC=CCCC(=O)NCC(=CCl)C12OC1C(O)CCC2=O)OC | InChI=1S/C24H38ClNO5/c1-3-4-5-6-8-11-19(30-2)12-9-7-10-13-22(29)26-17-18(16-25)24-21(28)15-14-20(27)23(24)31-24/h7,9,16,19-20,23,27H,3-6,8,10-15,17H2,1-2H3,(H,26,29) | WXDBUBIFYCCNLE-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 331.23572319124634 | Organic compounds | Organoheterocyclic compounds | Oxepanes | Oxepanes | 2.15 | 315560 | 3 | 3 | WXDBUBIFYCCNLE | <Binary: 256 bytes> | 421 | <Binary: 256 bytes> | 65 | ||||
| 4 | 4 | 4 | CCMSLIB00000001550 | [M+H]1+ | isolated | Scytonemin | 545.0 | 544.14230712 | 1 | positive | O=C1C(=Cc2ccc(O)cc2)C2=Nc3ccccc3C2=C1C1=C2C(=Nc3ccccc32)C(=Cc2ccc(O)cc2)C1=O | InChI=1S/C36H20N2O4/c39-21-13-9-19(10-14-21)17-25-33-29(23-5-1-3-7-27(23)37-33)31(35(25)41)32-30-24-6-2-4-8-28(24)38-34(30)26(36(32)42)18-20-11-15-22(40)16-12-20/h1-18,39-40H | CGZKSPLDUIRCIO-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 274.39275052211826 | Organic compounds | Organoheterocyclic compounds | Indoles and derivatives | Indoles and derivatives | 0.33 | 373931 | 4 | 4 | CGZKSPLDUIRCIO | <Binary: 256 bytes> | 791 | <Binary: 256 bytes> | 36 | ||||
| 5 | 5 | 5 | CCMSLIB00000001551 | [M+H]1+ | isolated | Salinisporamide A | 314.116 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 143133 | 5 | 5 | |||||||||||||||||||
| 6 | 6 | 6 | CCMSLIB00000001552 | [M+H]1+ | isolated | Hectochlorin | 667.115 | 666.1053279380001 | 1 | positive | CC(=O)OC1c2nc(cs2)C(=O)OC(CCCC(C)(Cl)[37Cl])C(C)C(=O)OC(C(C)(C)O)c2nc(cs2)C(=O)OC1(C)C | InChI=1S/C27H34Cl2N2O9S2/c1-13-17(9-8-10-27(7,28)29)38-23(34)15-11-42-21(30-15)19(37-14(2)32)26(5,6)40-24(35)16-12-41-20(31-16)18(25(3,4)36)39-22(13)33/h11-13,17-19,36H,8-10H2,1-7H3/i28+2 | USXIYWCPCGVOKF-CRTVXBCISA-N | qtof | ESI | GNPS-LIBRARY | 3006.1655389726047 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.73 | 417401 | 6 | 6 | USXIYWCPCGVOKF | <Binary: 256 bytes> | 643 | <Binary: 256 bytes> | 69 | |||
| 7 | 7 | 7 | CCMSLIB00000001553 | [M+H]1+ | isolated | Hectochlorin | 689.0 | 664.1082780280001 | 1 | positive | CC(=O)OC1c2nc(cs2)C(=O)OC(CCCC(C)(Cl)Cl)C(C)C(=O)OC(C(C)(C)O)c2nc(cs2)C(=O)OC1(C)C | InChI=1S/C27H34Cl2N2O9S2/c1-13-17(9-8-10-27(7,28)29)38-23(34)15-11-42-21(30-15)19(37-14(2)32)26(5,6)40-24(35)16-12-41-20(31-16)18(25(3,4)36)39-22(13)33/h11-13,17-19,36H,8-10H2,1-7H3 | USXIYWCPCGVOKF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 35910.22245992388 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.73 | 421157 | 7 | 7 | USXIYWCPCGVOKF | <Binary: 256 bytes> | 643 | <Binary: 256 bytes> | 67 | |||
| 8 | 8 | 8 | CCMSLIB00000001554 | [M-H2O+H]1+ | isolated | Cyclomarin A | 1025.61 | 1042.610305444 | 1 | positive | COC(c1ccccc1)C1NC(=O)C(C)NC(=O)C(CC(C)CO)N(C)C(=O)C(C(O)c2cn(C(C)(C)C3CO3)c3ccccc23)NC(=O)C(C(C)C=C(C)C)NC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC1=O | InChI=1S/C56H82N8O11/c1-30(2)24-34(8)44-52(70)60-45(47(66)38-27-64(56(10,11)42-29-75-42)39-23-19-18-22-37(38)39)55(73)63(13)41(26-33(7)28-65)50(68)57-35(9)49(67)61-46(48(74-14)36-20-16-15-17-21-36)53(71)58-43(32(5)6)54(72)62(12)40(25-31(3)4)51(69)59-44/h15-24,27,31-35,40-48,65-66H,25-26,28-29H2,1-14H3,(H,57,68)(H,58,71)(H,59,69)(H,60,70)(H,61,67) | WCNJVJCYRBJSLC-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.9046017031674563 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 0.87 | 458092 | 8 | 8 | WCNJVJCYRBJSLC | <Binary: 256 bytes> | 878 | <Binary: 256 bytes> | 93 | |||
| 9 | 9 | 9 | CCMSLIB00000001555 | [M+H]1+ | isolated | Hectochlorin | 665.115 | 664.1082780280001 | 1 | positive | CC(=O)OC1c2nc(cs2)C(=O)OC(CCCC(C)(Cl)Cl)C(C)C(=O)OC(C(C)(C)O)c2nc(cs2)C(=O)OC1(C)C | InChI=1S/C27H34Cl2N2O9S2/c1-13-17(9-8-10-27(7,28)29)38-23(34)15-11-42-21(30-15)19(37-14(2)32)26(5,6)40-24(35)16-12-41-20(31-16)18(25(3,4)36)39-22(13)33/h11-13,17-19,36H,8-10H2,1-7H3 | USXIYWCPCGVOKF-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 0.8307526382049505 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.73 | 417009 | 9 | 9 | USXIYWCPCGVOKF | <Binary: 256 bytes> | 643 | <Binary: 256 bytes> | 67 | |||
| 10 | 10 | 10 | CCMSLIB00000001556 | [M+Na]1+ | isolated | Cyclomarin A | 1065.6 | 1042.610305444 | 1 | positive | COC(c1ccccc1)C1NC(=O)C(C)NC(=O)C(CC(C)CO)N(C)C(=O)C(C(O)c2cn(C(C)(C)C3CO3)c3ccccc23)NC(=O)C(C(C)C=C(C)C)NC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC1=O | InChI=1S/C56H82N8O11/c1-30(2)24-34(8)44-52(70)60-45(47(66)38-27-64(56(10,11)42-29-75-42)39-23-19-18-22-37(38)39)55(73)63(13)41(26-33(7)28-65)50(68)57-35(9)49(67)61-46(48(74-14)36-20-16-15-17-21-36)53(71)58-43(32(5)6)54(72)62(12)40(25-31(3)4)51(69)59-44/h15-24,27,31-35,40-48,65-66H,25-26,28-29H2,1-14H3,(H,57,68)(H,58,71)(H,59,69)(H,60,70)(H,61,67) | WCNJVJCYRBJSLC-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.4407545110454463 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 0.87 | 459244 | 10 | 10 | WCNJVJCYRBJSLC | <Binary: 256 bytes> | 878 | <Binary: 256 bytes> | 93 | |||
| 11 | 11 | 11 | CCMSLIB00000001557 | [M+H]1+ | isolated | Halimide B | 351.182 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 200328 | 11 | 11 | |||||||||||||||||||
| 12 | 12 | 12 | CCMSLIB00000001558 | [M+Na]1+ | isolated | Hectochlorin | 687.0 | 664.1082780280001 | 1 | positive | CC(=O)OC1c2nc(cs2)C(=O)OC(CCCC(C)(Cl)Cl)C(C)C(=O)OC(C(C)(C)O)c2nc(cs2)C(=O)OC1(C)C | InChI=1S/C27H34Cl2N2O9S2/c1-13-17(9-8-10-27(7,28)29)38-23(34)15-11-42-21(30-15)19(37-14(2)32)26(5,6)40-24(35)16-12-41-20(31-16)18(25(3,4)36)39-22(13)33/h11-13,17-19,36H,8-10H2,1-7H3 | USXIYWCPCGVOKF-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 141.89659379479903 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.73 | 420737 | 12 | 12 | USXIYWCPCGVOKF | <Binary: 256 bytes> | 643 | <Binary: 256 bytes> | 67 | |||
| 13 | 13 | 13 | CCMSLIB00000001559 | [M+Na]1+ | isolated | Halimide B | 373.164 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 227794 | 13 | 13 | |||||||||||||||||||
| 14 | 14 | 14 | CCMSLIB00000001560 | [M+H]1+ | isolated | Jamaicamide A | 569.0 | 566.154697412 | 1 | positive | COC(=CC(=O)N1C(=O)C=CC1C)CCNC(=O)CCC=CC(C)CCC(=CCl)CCCC#CBr | InChI=1S/C27H36BrClN2O4/c1-21(12-14-23(20-29)10-5-4-8-17-28)9-6-7-11-25(32)30-18-16-24(35-3)19-27(34)31-22(2)13-15-26(31)33/h6,9,13,15,19-22H,4-5,7,10-12,14,16,18H2,1-3H3,(H,30,32) | NAIKIJSSBJHCBL-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 3240.7398086421213 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.57 | 384585 | 14 | 14 | NAIKIJSSBJHCBL | <Binary: 256 bytes> | 362 | <Binary: 256 bytes> | 72 | |||
| 15 | 15 | 15 | CCMSLIB00000001561 | [M+H]1+ | isolated | Orellin B | 438.152 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 298144 | 15 | 15 | |||||||||||||||||||
| 16 | 16 | 16 | CCMSLIB00000001562 | [M+H]1+ | isolated | Jamaicamide A | 591.0 | 566.154697412 | 1 | positive | COC(=CC(=O)N1C(=O)C=CC1C)CCNC(=O)CCC=CC(C)CCC(=CCl)CCCC#CBr | InChI=1S/C27H36BrClN2O4/c1-21(12-14-23(20-29)10-5-4-8-17-28)9-6-7-11-25(32)30-18-16-24(35-3)19-27(34)31-22(2)13-15-26(31)33/h6,9,13,15,19-22H,4-5,7,10-12,14,16,18H2,1-3H3,(H,30,32) | NAIKIJSSBJHCBL-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 42030.36419491651 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.57 | 393254 | 16 | 16 | NAIKIJSSBJHCBL | <Binary: 256 bytes> | 362 | <Binary: 256 bytes> | 72 | |||
| 17 | 17 | 17 | CCMSLIB00000001563 | [M+H]1+ | isolated | Exumolide A | 730.418 | 729.4101490999999 | 1 | positive | CC(C)CC1OC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(C)C)N(C)C(=O)C2CCCN2C1=O | InChI=1S/C41H55N5O7/c1-26(2)22-34-37(48)42-30(24-28-14-8-6-9-15-28)36(47)43-31(25-29-16-10-7-11-17-29)38(49)46-21-13-19-33(46)41(52)53-35(23-27(3)4)40(51)45-20-12-18-32(45)39(50)44(34)5/h6-11,14-17,26-27,30-35H,12-13,18-25H2,1-5H3,(H,42,48)(H,43,47) | GWGKNTICBPKKKW-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.7828159322691061 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.01 | 427691 | 17 | 17 | GWGKNTICBPKKKW | <Binary: 256 bytes> | 678 | <Binary: 256 bytes> | 60 | |||
| 18 | 18 | 18 | CCMSLIB00000001564 | [M+H]1+ | isolated | Jamaicamide A | 567.0 | 566.154697412 | 1 | positive | COC(=CC(=O)N1C(=O)C=CC1C)CCNC(=O)CCC=CC(C)CCC(=CCl)CCCC#CBr | InChI=1S/C27H36BrClN2O4/c1-21(12-14-23(20-29)10-5-4-8-17-28)9-6-7-11-25(32)30-18-16-24(35-3)19-27(34)31-22(2)13-15-26(31)33/h6,9,13,15,19-22H,4-5,7,10-12,14,16,18H2,1-3H3,(H,30,32) | NAIKIJSSBJHCBL-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 285.5896810191866 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.57 | 383714 | 18 | 18 | NAIKIJSSBJHCBL | <Binary: 256 bytes> | 362 | <Binary: 256 bytes> | 72 | |||
| 19 | 19 | 19 | CCMSLIB00000001565 | [M+Na]1+ | isolated | Jamaicamide A | 589.0 | 566.154697412 | 1 | positive | COC(=CC(=O)N1C(=O)C=CC1C)CCNC(=O)CCC=CC(C)CCC(=CCl)CCCC#CBr | InChI=1S/C27H36BrClN2O4/c1-21(12-14-23(20-29)10-5-4-8-17-28)9-6-7-11-25(32)30-18-16-24(35-3)19-27(34)31-22(2)13-15-26(31)33/h6,9,13,15,19-22H,4-5,7,10-12,14,16,18H2,1-3H3,(H,30,32) | NAIKIJSSBJHCBL-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 244.2864141504671 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.57 | 392676 | 19 | 19 | NAIKIJSSBJHCBL | <Binary: 256 bytes> | 362 | <Binary: 256 bytes> | 72 | |||
| 20 | 20 | 20 | CCMSLIB00000001566 | [M+Na]1+ | isolated | Exumolide A | 752.399 | 729.4101490999999 | 1 | positive | CC(C)CC1OC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccccc2)NC(=O)C(CC(C)C)N(C)C(=O)C2CCCN2C1=O | InChI=1S/C41H55N5O7/c1-26(2)22-34-37(48)42-30(24-28-14-8-6-9-15-28)36(47)43-31(25-29-16-10-7-11-17-29)38(49)46-21-13-19-33(46)41(52)53-35(23-27(3)4)40(51)45-20-12-18-32(45)39(50)44(34)5/h6-11,14-17,26-27,30-35H,12-13,18-25H2,1-5H3,(H,42,48)(H,43,47) | GWGKNTICBPKKKW-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.4950369625049744 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.01 | 431161 | 20 | 20 | GWGKNTICBPKKKW | <Binary: 256 bytes> | 678 | <Binary: 256 bytes> | 60 | |||
| 21 | 21 | 21 | CCMSLIB00000001567 | [M+H]1+ | isolated | Jamaicamide B | 491.0 | 488.244185344 | 1 | positive | C#CCCCC(=CCl)CCC(C)C=CCCC(=O)NCCC(=CC(=O)N1C(=O)C=CC1C)OC | InChI=1S/C27H37ClN2O4/c1-5-6-7-11-23(20-28)15-13-21(2)10-8-9-12-25(31)29-18-17-24(34-4)19-27(33)30-22(3)14-16-26(30)32/h1,8,10,14,16,19-22H,6-7,9,11-13,15,17-18H2,2-4H3,(H,29,31) | KZVHAGNFWJIOMX-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 3573.907286681136 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.36 | 343700 | 21 | 21 | KZVHAGNFWJIOMX | <Binary: 256 bytes> | 353 | <Binary: 256 bytes> | 70 | |||
| 22 | 22 | 22 | CCMSLIB00000001568 | [M+Na]1+ | isolated | Halovir B | 860.584 | 837.5939271079999 | 1 | positive | CCCCCCCCCCCCCC(=O)NC(C)(C)C(=O)N1CC(O)CC1C(=O)NC(CC(C)C)C(=O)NC(C)C(=O)NC(CCC(N)=O)C(=O)NC(CO)CC(C)C | InChI=1S/C43H79N7O9/c1-9-10-11-12-13-14-15-16-17-18-19-20-37(54)49-43(7,8)42(59)50-26-32(52)25-35(50)41(58)48-34(24-29(4)5)40(57)45-30(6)38(55)47-33(21-22-36(44)53)39(56)46-31(27-51)23-28(2)3/h28-35,51-52H,9-27H2,1-8H3,(H2,44,53)(H,45,57)(H,46,56)(H,47,55)(H,48,58)(H,49,54) | FFCLYSVFZQXUHI-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.9862662296017904 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Oligopeptides | -0.12 | 446409 | 22 | 22 | FFCLYSVFZQXUHI | <Binary: 256 bytes> | 556 | <Binary: 256 bytes> | 72 | |||
| 23 | 23 | 23 | CCMSLIB00000001569 | [M+H]1+ | isolated | Jamaicamide B | 489.0 | 488.244185344 | 1 | positive | C#CCCCC(=CCl)CCC(C)C=CCCC(=O)NCCC(=CC(=O)N1C(=O)C=CC1C)OC | InChI=1S/C27H37ClN2O4/c1-5-6-7-11-23(20-28)15-13-21(2)10-8-9-12-25(31)29-18-17-24(34-4)19-27(33)30-22(3)14-16-26(30)32/h1,8,10,14,16,19-22H,6-7,9,11-13,15,17-18H2,2-4H3,(H,29,31) | KZVHAGNFWJIOMX-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 513.9701360752025 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.36 | 342425 | 23 | 23 | KZVHAGNFWJIOMX | <Binary: 256 bytes> | 353 | <Binary: 256 bytes> | 70 | |||
| 24 | 24 | 24 | CCMSLIB00000001570 | [M+H]1+ | isolated | Halovir A | 866.633 | 865.625227236 | 1 | positive | CCCCCCCCCCCCCC(=O)NC(C)(C)C(=O)N1CC(O)CC1C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CCC(N)=O)C(=O)NC(CO)CC(C)C)C(C)C | InChI=1S/C45H83N7O9/c1-10-11-12-13-14-15-16-17-18-19-20-21-38(56)51-45(8,9)44(61)52-27-33(54)26-36(52)42(59)49-35(25-30(4)5)41(58)50-39(31(6)7)43(60)48-34(22-23-37(46)55)40(57)47-32(28-53)24-29(2)3/h29-36,39,53-54H,10-28H2,1-9H3,(H2,46,55)(H,47,57)(H,48,60)(H,49,59)(H,50,58)(H,51,56) | GRJSOZDXIUZXEW-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.568734262775058 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Oligopeptides | -0.09 | 447049 | 24 | 24 | GRJSOZDXIUZXEW | <Binary: 256 bytes> | 578 | <Binary: 256 bytes> | 74 | |||
| 25 | 25 | 25 | CCMSLIB00000001571 | [M+Na]1+ | isolated | Jamaicamide B | 511.0 | 488.244185344 | 1 | positive | C#CCCCC(=CCl)CCC(C)C=CCCC(=O)NCCC(=CC(=O)N1C(=O)C=CC1C)OC | InChI=1S/C27H37ClN2O4/c1-5-6-7-11-23(20-28)15-13-21(2)10-8-9-12-25(31)29-18-17-24(34-4)19-27(33)30-22(3)14-16-26(30)32/h1,8,10,14,16,19-22H,6-7,9,11-13,15,17-18H2,2-4H3,(H,29,31) | KZVHAGNFWJIOMX-UHFFFAOYSA-N | ftms | ESI | GNPS-LIBRARY | 456.55249729105714 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Carboxylic acid derivatives | N-substituted carboxylic acid imides | 1.36 | 356081 | 25 | 25 | KZVHAGNFWJIOMX | <Binary: 256 bytes> | 353 | <Binary: 256 bytes> | 70 | |||
| 26 | 26 | 26 | CCMSLIB00000001572 | [M+Na]1+ | isolated | Halovir A | 888.615 | 865.625227236 | 1 | positive | CCCCCCCCCCCCCC(=O)NC(C)(C)C(=O)N1CC(O)CC1C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CCC(N)=O)C(=O)NC(CO)CC(C)C)C(C)C | InChI=1S/C45H83N7O9/c1-10-11-12-13-14-15-16-17-18-19-20-21-38(56)51-45(8,9)44(61)52-27-33(54)26-36(52)42(59)49-35(25-30(4)5)41(58)50-39(31(6)7)43(60)48-34(22-23-37(46)55)40(57)47-32(28-53)24-29(2)3/h29-36,39,53-54H,10-28H2,1-9H3,(H2,46,55)(H,47,57)(H,48,60)(H,49,59)(H,50,58)(H,51,56) | GRJSOZDXIUZXEW-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.6174057816641989 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Oligopeptides | -0.09 | 449468 | 26 | 26 | GRJSOZDXIUZXEW | <Binary: 256 bytes> | 578 | <Binary: 256 bytes> | 74 | |||
| 27 | 27 | 27 | CCMSLIB00000001573 | [M+H]1+ | isolated | Barbamide | 463.0 | 460.054582016 | 1 | positive | COC(=CC(=O)N(C)C(Cc1ccccc1)c1nccs1)CC(C)C(Cl)(Cl)Cl | InChI=1S/C20H23Cl3N2O2S/c1-14(20(21,22)23)11-16(27-3)13-18(26)25(2)17(19-24-9-10-28-19)12-15-7-5-4-6-8-15/h4-10,13-14,17H,11-12H2,1-3H3 | UGNRFJOMRFTXSQ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 4203.66335468808 | Organic compounds | Benzenoids | Benzene and substituted derivatives | Phenethylamines | Amphetamines and derivatives | 0.21 | 321145 | 27 | 27 | UGNRFJOMRFTXSQ | <Binary: 256 bytes> | 397 | <Binary: 256 bytes> | 56 | |||
| 28 | 28 | 28 | CCMSLIB00000001574 | [M+H]1+ | isolated | Microsporin A | 513.308 | 512.29987038 | 1 | positive | CCC(=O)CCCCCC1NC(=O)C2CCCCN2C(=O)C(Cc2ccccc2)NC(=O)C(C)NC1=O | InChI=1S/C28H40N4O5/c1-3-21(33)14-8-5-9-15-22-26(35)29-19(2)25(34)31-23(18-20-12-6-4-7-13-20)28(37)32-17-11-10-16-24(32)27(36)30-22/h4,6-7,12-13,19,22-24H,3,5,8-11,14-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,34) | DEUCVOIWOGPZGS-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.6583908915224923 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.04 | 357444 | 28 | 28 | DEUCVOIWOGPZGS | <Binary: 256 bytes> | 454 | <Binary: 256 bytes> | 60 | |||
| 29 | 29 | 29 | CCMSLIB00000001575 | [M+H]1+ | isolated | Barbamide | 461.0 | 460.054582016 | 1 | positive | COC(=CC(=O)N(C)C(Cc1ccccc1)c1nccs1)CC(C)C(Cl)(Cl)Cl | InChI=1S/C20H23Cl3N2O2S/c1-14(20(21,22)23)11-16(27-3)13-18(26)25(2)17(19-24-9-10-28-19)12-15-7-5-4-6-8-15/h4-10,13-14,17H,11-12H2,1-3H3 | UGNRFJOMRFTXSQ-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 134.14944598011928 | Organic compounds | Benzenoids | Benzene and substituted derivatives | Phenethylamines | Amphetamines and derivatives | 0.21 | 319032 | 29 | 29 | UGNRFJOMRFTXSQ | <Binary: 256 bytes> | 397 | <Binary: 256 bytes> | 56 | |||
| 30 | 30 | 30 | CCMSLIB00000001576 | [M+Na]1+ | isolated | Microsporin A | 535.29 | 512.29987038 | 1 | positive | CCC(=O)CCCCCC1NC(=O)C2CCCCN2C(=O)C(Cc2ccccc2)NC(=O)C(C)NC1=O | InChI=1S/C28H40N4O5/c1-3-21(33)14-8-5-9-15-22-26(35)29-19(2)25(34)31-23(18-20-12-6-4-7-13-20)28(37)32-17-11-10-16-24(32)27(36)30-22/h4,6-7,12-13,19,22-24H,3,5,8-11,14-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,34) | DEUCVOIWOGPZGS-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.694441399640798 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.04 | 368948 | 30 | 30 | DEUCVOIWOGPZGS | <Binary: 256 bytes> | 454 | <Binary: 256 bytes> | 60 | |||
| 31 | 31 | 31 | CCMSLIB00000001577 | [M+H]1+ | isolated | Carmaphycin B | 532.0 | 531.2978217799999 | 1 | positive | CCCCCC(=O)NC(C(=O)NC(CCS(C)(=O)=O)C(=O)NC(CC(C)C)C(=O)C1(C)CO1)C(C)C | InChI=1S/C25H45N3O7S/c1-8-9-10-11-20(29)28-21(17(4)5)24(32)26-18(12-13-36(7,33)34)23(31)27-19(14-16(2)3)22(30)25(6)15-35-25/h16-19,21H,8-15H2,1-7H3,(H,26,32)(H,27,31)(H,28,29) | ODAZGDXFSFEAAA-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 573.1692174004326 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Peptides | 0.18 | 367251 | 31 | 31 | ODAZGDXFSFEAAA | <Binary: 256 bytes> | 433 | <Binary: 256 bytes> | 54 | |||
| 32 | 32 | 32 | CCMSLIB00000001578 | [M+H]1+ | isolated | unpublished peptide from CNL 643 | 1068.61 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 459297 | 32 | 32 | |||||||||||||||||||
| 33 | 33 | 33 | CCMSLIB00000001579 | [M+H]1+ | isolated | Tumonoic Acid H | 484.0 | 483.3196027799999 | 1 | positive | CCCCCCCCC(C)C(=O)N1CCCC1C(=O)OC(C(=O)OC(C(=O)O)C(C)C)C(C)C | InChI=1S/C26H45NO7/c1-7-8-9-10-11-12-14-19(6)23(28)27-16-13-15-20(27)25(31)34-22(18(4)5)26(32)33-21(17(2)3)24(29)30/h17-22H,7-16H2,1-6H3,(H,29,30) | XZDDLHQSVWZOPD-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 674.9199947769999 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Depsipeptides | 0.67 | 339351 | 33 | 33 | XZDDLHQSVWZOPD | <Binary: 256 bytes> | 394 | <Binary: 256 bytes> | 49 | |||
| 34 | 34 | 34 | CCMSLIB00000001580 | [M+Na]1+ | isolated | unpublished peptide from CNL 643 | 1082.62 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 459806 | 34 | 34 | |||||||||||||||||||
| 35 | 35 | 35 | CCMSLIB00000001581 | [M+H]1+ | isolated | Palmyramide A | 672.1 | 671.3781802760001 | 1 | positive | CCCC1OC(=O)C(C(C)C)NC(=O)C(C(C)C)N(C)C(=O)C2CCCN2C(=O)C(Cc2ccccc2)OC(=O)C(C)OC(=O)C1(C)C | InChI=1S/C36H53N3O9/c1-10-15-27-36(7,8)35(45)46-23(6)33(43)47-26(20-24-16-12-11-13-17-24)32(42)39-19-14-18-25(39)31(41)38(9)29(22(4)5)30(40)37-28(21(2)3)34(44)48-27/h11-13,16-17,21-23,25-29H,10,14-15,18-20H2,1-9H3,(H,37,40) | QXWOTWUQMDHDCF-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 424.5483733911431 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.62 | 418226 | 35 | 35 | QXWOTWUQMDHDCF | <Binary: 256 bytes> | 649 | <Binary: 256 bytes> | 73 | |||
| 36 | 36 | 36 | CCMSLIB00000001582 | [M+H]1+ | isolated | unpublished peptide11M4 | 990.598 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 457183 | 36 | 36 | |||||||||||||||||||
| 37 | 37 | 37 | CCMSLIB00000001583 | [M+H]1+ | isolated | Tumonoic Acid I | 497.9 | 497.3352528439999 | 1 | positive | CCCCC(C)CC(C)C(=O)N1CCCC1C(=O)OC(C(=O)OC(C(=O)O)C(C)CC)C(C)CC | InChI=1S/C27H47NO7/c1-8-11-13-17(4)16-20(7)24(29)28-15-12-14-21(28)26(32)35-23(19(6)10-3)27(33)34-22(25(30)31)18(5)9-2/h17-23H,8-16H2,1-7H3,(H,30,31) | LWUJNFXMOSWRGO-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 888.0076100646324 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Depsipeptides | 0.84 | 348498 | 37 | 37 | LWUJNFXMOSWRGO | <Binary: 256 bytes> | 413 | <Binary: 256 bytes> | 53 | |||
| 38 | 38 | 38 | CCMSLIB00000001584 | [M+H]1+ | isolated | Glucopiericidin | 578.333 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 388610 | 38 | 38 | |||||||||||||||||||
| 39 | 39 | 39 | CCMSLIB00000001585 | [M+H]1+ | isolated | Tumonoic Acid I | 498.1 | 497.3352528439999 | 1 | positive | CCCCC(C)CC(C)C(=O)N1CCCC1C(=O)OC(C(=O)OC(C(=O)O)C(C)CC)C(C)CC | InChI=1S/C27H47NO7/c1-8-11-13-17(4)16-20(7)24(29)28-15-12-14-21(28)26(32)35-23(19(6)10-3)27(33)34-22(25(30)31)18(5)9-2/h17-23H,8-16H2,1-7H3,(H,30,31) | LWUJNFXMOSWRGO-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 486.677225493368 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Depsipeptides | 0.84 | 348567 | 39 | 39 | LWUJNFXMOSWRGO | <Binary: 256 bytes> | 413 | <Binary: 256 bytes> | 53 | |||
| 40 | 40 | 40 | CCMSLIB00000001586 | [M+Na]1+ | isolated | Glucopiericidin | 600.314 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 396928 | 40 | 40 | |||||||||||||||||||
| 41 | 41 | 41 | CCMSLIB00000001587 | [M+H]1+ | isolated | Malyngamide K | 424.0 | 423.25402175599993 | 1 | positive | CCCCCCCC(CC=CCCC(=O)NCC(=CCl)C1=CCCCC1=O)OC | InChI=1S/C24H38ClNO3/c1-3-4-5-6-8-13-21(29-2)14-9-7-10-17-24(28)26-19-20(18-25)22-15-11-12-16-23(22)27/h7,9,15,18,21H,3-6,8,10-14,16-17,19H2,1-2H3,(H,26,28) | MFDHYPQDDSVRFS-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 615.8861860597649 | Organic compounds | Organic oxygen compounds | Organooxygen compounds | Carbonyl compounds | Cyclohexenones | 1.27 | 283061 | 41 | 41 | MFDHYPQDDSVRFS | <Binary: 256 bytes> | 284 | <Binary: 256 bytes> | 60 | |||
| 42 | 42 | 42 | CCMSLIB00000001588 | [M+H]1+ | isolated | unpublished ME5.F6 | 566.428 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 383405 | 42 | 42 | |||||||||||||||||||
| 43 | 43 | 43 | CCMSLIB00000001589 | [M+H]1+ | isolated | Malyngamide_J | 607.9 | 607.3720322759998 | 1 | positive | C=C(CCNC(=O)CCC=CCC(CCCCCCC)OC)C12OC1C(OC1OCC(OC)C(O)C1OC)C=C(C)C2=O | InChI=1S/C33H53NO9/c1-7-8-9-10-12-15-24(38-4)16-13-11-14-17-27(35)34-19-18-23(3)33-30(37)22(2)20-25(31(33)43-33)42-32-29(40-6)28(36)26(39-5)21-41-32/h11,13,20,24-26,28-29,31-32,36H,3,7-10,12,14-19,21H2,1-2,4-6H3,(H,34,35) | UZMVEOVJASEKLP-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 787.8508421062667 | Organic compounds | Organic oxygen compounds | Organooxygen compounds | Carbohydrates and carbohydrate conjugates | O-glycosyl compounds | 2.03 | 399667 | 43 | 43 | UZMVEOVJASEKLP | <Binary: 256 bytes> | 571 | <Binary: 256 bytes> | 83 | |||
| 44 | 44 | 44 | CCMSLIB00000001590 | [M+H]1+ | isolated | Microsporin B | 515.322 | 514.315520444 | 1 | positive | CCC(O)CCCCCC1NC(=O)C2CCCCN2C(=O)C(Cc2ccccc2)NC(=O)C(C)NC1=O | InChI=1S/C28H42N4O5/c1-3-21(33)14-8-5-9-15-22-26(35)29-19(2)25(34)31-23(18-20-12-6-4-7-13-20)28(37)32-17-11-10-16-24(32)27(36)30-22/h4,6-7,12-13,19,21-24,33H,3,5,8-11,14-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,34) | ZRWKFXOGNFQPMY-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.5500969525573645 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.13 | 358433 | 44 | 44 | ZRWKFXOGNFQPMY | <Binary: 256 bytes> | 458 | <Binary: 256 bytes> | 61 | |||
| 45 | 45 | 45 | CCMSLIB00000001591 | [M+H]1+ | isolated | Malyngamide J | 608.0 | 607.3720322759998 | 1 | positive | C=C(CCNC(=O)CCC=CCC(CCCCCCC)OC)C12OC1C(OC1OCC(OC)C(O)C1OC)C=C(C)C2=O | InChI=1S/C33H53NO9/c1-7-8-9-10-12-15-24(38-4)16-13-11-14-17-27(35)34-19-18-23(3)33-30(37)22(2)20-25(31(33)43-33)42-32-29(40-6)28(36)26(39-5)21-41-32/h11,13,20,24-26,28-29,31-32,36H,3,7-10,12,14-19,21H2,1-2,4-6H3,(H,34,35) | UZMVEOVJASEKLP-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 623.4797038996338 | Organic compounds | Organic oxygen compounds | Organooxygen compounds | Carbohydrates and carbohydrate conjugates | O-glycosyl compounds | 2.03 | 399668 | 45 | 45 | UZMVEOVJASEKLP | <Binary: 256 bytes> | 571 | <Binary: 256 bytes> | 83 | |||
| 46 | 46 | 46 | CCMSLIB00000001592 | [M+Na]1+ | isolated | Microsporin B | 537.304 | 514.315520444 | 1 | positive | CCC(O)CCCCCC1NC(=O)C2CCCCN2C(=O)C(Cc2ccccc2)NC(=O)C(C)NC1=O | InChI=1S/C28H42N4O5/c1-3-21(33)14-8-5-9-15-22-26(35)29-19(2)25(34)31-23(18-20-12-6-4-7-13-20)28(37)32-17-11-10-16-24(32)27(36)30-22/h4,6-7,12-13,19,21-24,33H,3,5,8-11,14-18H2,1-2H3,(H,29,35)(H,30,36)(H,31,34) | ZRWKFXOGNFQPMY-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.3829176265291234 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.13 | 369825 | 46 | 46 | ZRWKFXOGNFQPMY | <Binary: 256 bytes> | 458 | <Binary: 256 bytes> | 61 | |||
| 47 | 47 | 47 | CCMSLIB00000001593 | [M+H]1+ | isolated | Malyngamide C acetate | 498.0 | 1 | positive | ESI | GNPS-LIBRARY | 348502 | 47 | 47 | ||||||||||||||||||||
| 48 | 48 | 48 | CCMSLIB00000001594 | [M+H]1+ | isolated | Microsporin C | 584.285 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 390873 | 48 | 48 | |||||||||||||||||||
| 49 | 49 | 49 | CCMSLIB00000001595 | [M+H]1+ | isolated | Carmabin A | 687.1 | 703.430884544 | 1 | positive | C#CCCCCC(C)CC(C)C(=O)N(C)C(Cc1ccccc1)C(=O)NC(C)C(=O)N(C)C(C)C(=O)N(C)C(Cc1ccc(OC)cc1)C(N)=O | InChI=1S/C40H57N5O6/c1-10-11-12-14-17-27(2)24-28(3)38(48)45(8)35(26-31-18-15-13-16-19-31)37(47)42-29(4)39(49)43(6)30(5)40(50)44(7)34(36(41)46)25-32-20-22-33(51-9)23-21-32/h1,13,15-16,18-23,27-30,34-35H,11-12,14,17,24-26H2,2-9H3,(H2,41,46)(H,42,47) | BRWIYXLUWTZWGU-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 24612.754086214976 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Peptides | 0.45 | 420743 | 49 | 49 | BRWIYXLUWTZWGU | <Binary: 256 bytes> | 526 | <Binary: 256 bytes> | 69 | |||
| 50 | 50 | 50 | CCMSLIB00000001596 | [M+Na]1+ | isolated | Microsporin C | 606.267 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 399259 | 50 | 50 | |||||||||||||||||||
| 51 | 51 | 51 | CCMSLIB00000001597 | [M+H]1+ | isolated | Stypoldione | 427.0 | 426.277009696 | 1 | positive | CC1=C2OC3(C=C2C(=O)C(=O)C1)C(C)CCC1C2(C)CCC(O)C(C)(C)C2CCC13C | InChI=1S/C27H38O4/c1-15-13-18(28)22(30)17-14-27(31-23(15)17)16(2)7-8-20-25(5)11-10-21(29)24(3,4)19(25)9-12-26(20,27)6/h14,16,19-21,29H,7-13H2,1-6H3 | DQXVZKNDVNCDQE-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 665.3361242206831 | Organic compounds | Lipids and lipid-like molecules | Prenol lipids | Sesterterpenoids | Sesterterpenoids | 2.4 | 285941 | 51 | 51 | DQXVZKNDVNCDQE | <Binary: 256 bytes> | 852 | <Binary: 256 bytes> | 52 | |||
| 52 | 52 | 52 | CCMSLIB00000001598 | [M+H]1+ | isolated | Halovir C | 850.636 | 849.6303126160001 | 1 | positive | CCCCCCCCCCCCCC(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C(=O)NC(CCC(N)=O)C(=O)NC(CO)CC(C)C)C(C)C | InChI=1S/C45H83N7O8/c1-10-11-12-13-14-15-16-17-18-19-20-23-38(55)51-45(8,9)44(60)52-26-21-22-36(52)42(58)49-35(28-31(4)5)41(57)50-39(32(6)7)43(59)48-34(24-25-37(46)54)40(56)47-33(29-53)27-30(2)3/h30-36,39,53H,10-29H2,1-9H3,(H2,46,54)(H,47,56)(H,48,59)(H,49,58)(H,50,57)(H,51,55) | VCAGNEUDNVLWPT-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.871674159245896 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Oligopeptides | -0.24 | 445458 | 52 | 52 | VCAGNEUDNVLWPT | <Binary: 256 bytes> | 551 | <Binary: 256 bytes> | 73 | |||
| 53 | 53 | 53 | CCMSLIB00000001599 | [M+H]1+ | isolated | Stypoltrione | 424.9 | 1 | positive | ESI | GNPS-LIBRARY | 283774 | 53 | 53 | ||||||||||||||||||||
| 54 | 54 | 54 | CCMSLIB00000001600 | [M+H]1+ | isolated | Oxepinamide A | 348.155 | 347.148120772 | 1 | positive | CCC(C)C1(O)NC(=O)C(C)n2c1nc1c(c2=O)C=C(OC)C=CO1 | InChI=1S/C17H21N3O5/c1-5-9(2)17(23)16-18-14-12(8-11(24-4)6-7-25-14)15(22)20(16)10(3)13(21)19-17/h6-10,23H,5H2,1-4H3,(H,19,21) | LNZVLFKJDOYTAA-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.1464024429357187 | Organic compounds | Organoheterocyclic compounds | Diazines | Pyrimidines and pyrimidine derivatives | Pyrimidones | 1.08 | 196600 | 54 | 54 | LNZVLFKJDOYTAA | <Binary: 256 bytes> | 641 | <Binary: 256 bytes> | 55 | |||
| 55 | 55 | 55 | CCMSLIB00000001601 | [M+H]1+ | isolated | Apratoxin A | 840.0 | 839.486685168 | 1 | positive | CCC(C)C1C(=O)N2CCCC2C(=O)OC(C(C)(C)C)CC(C)CC(O)C(C)C2=NC(CS2)CC(C)C(=O)N=C(Cc2ccc(OC)cc2)C(=O)N(C)C(C)C(=O)N1C | InChI=1S/C45H69N5O8S/c1-13-27(3)38-43(55)50-20-14-15-35(50)44(56)58-37(45(7,8)9)22-26(2)21-36(51)29(5)40-46-32(25-59-40)23-28(4)39(52)47-34(24-31-16-18-33(57-12)19-17-31)42(54)48(10)30(6)41(53)49(38)11/h16-19,26-30,32,35-38,51H,13-15,20-25H2,1-12H3 | FEBXPWGNMBVKHP-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 587.7075734800896 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.86 | 444229 | 55 | 55 | FEBXPWGNMBVKHP | <Binary: 256 bytes> | 798 | <Binary: 256 bytes> | 96 | |||
| 56 | 56 | 56 | CCMSLIB00000001602 | [M+H]1+ | isolated | Thalassospiramide B | 1062.61 | 1061.604885716 | 1 | positive | CCCCCCC=CCC(=O)NC(Cc1ccccc1)C(O)CC(=O)NC(C(=O)NC(CO)C(O)CC(=O)NC(C(=O)NC1CCC(=O)N=C(C(C)C)C(=O)N(C)C(Cc2ccc(O)cc2)C(=O)OC1)C(C)C)C(C)C | InChI=1S/C56H83N7O13/c1-9-10-11-12-13-14-18-21-46(68)58-41(28-37-19-16-15-17-20-37)44(66)30-48(70)62-51(35(4)5)54(73)59-42(32-64)45(67)31-49(71)61-50(34(2)3)53(72)57-39-24-27-47(69)60-52(36(6)7)55(74)63(8)43(56(75)76-33-39)29-38-22-25-40(65)26-23-38/h14-20,22-23,25-26,34-36,39,41-45,50-51,64-67H,9-13,21,24,27-33H2,1-8H3,(H,57,72)(H,58,68)(H,59,73)(H,61,71)(H,62,70) | LTSUOBBLDXXDGS-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.039423664647851 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | N-acyl-alpha amino acids and derivatives | 0.54 | 459114 | 56 | 56 | LTSUOBBLDXXDGS | <Binary: 256 bytes> | 734 | <Binary: 256 bytes> | 101 | |||
| 57 | 57 | 57 | CCMSLIB00000001603 | [M+Na]1+ | isolated | Apratoxin A | 862.0 | 839.486685168 | 1 | positive | CCC(C)C1C(=O)N2CCCC2C(=O)OC(C(C)(C)C)CC(C)CC(O)C(C)C2=NC(CS2)CC(C)C(=O)N=C(Cc2ccc(OC)cc2)C(=O)N(C)C(C)C(=O)N1C | InChI=1S/C45H69N5O8S/c1-13-27(3)38-43(55)50-20-14-15-35(50)44(56)58-37(45(7,8)9)22-26(2)21-36(51)29(5)40-46-32(25-59-40)23-28(4)39(52)47-34(24-31-16-18-33(57-12)19-17-31)42(54)48(10)30(6)41(53)49(38)11/h16-19,26-30,32,35-38,51H,13-15,20-25H2,1-12H3 | FEBXPWGNMBVKHP-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 551.7938663329949 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.86 | 446565 | 57 | 57 | FEBXPWGNMBVKHP | <Binary: 256 bytes> | 798 | <Binary: 256 bytes> | 96 | |||
| 58 | 58 | 58 | CCMSLIB00000001604 | [M+H]1+ | isolated | Thalassospiramide B | 1084.59 | 1061.604885716 | 1 | positive | CCCCCCC=CCC(=O)NC(Cc1ccccc1)C(O)CC(=O)NC(C(=O)NC(CO)C(O)CC(=O)NC(C(=O)NC1CCC(=O)N=C(C(C)C)C(=O)N(C)C(Cc2ccc(O)cc2)C(=O)OC1)C(C)C)C(C)C | InChI=1S/C56H83N7O13/c1-9-10-11-12-13-14-18-21-46(68)58-41(28-37-19-16-15-17-20-37)44(66)30-48(70)62-51(35(4)5)54(73)59-42(32-64)45(67)31-49(71)61-50(34(2)3)53(72)57-39-24-27-47(69)60-52(36(6)7)55(74)63(8)43(56(75)76-33-39)29-38-22-25-40(65)26-23-38/h14-20,22-23,25-26,34-36,39,41-45,50-51,64-67H,9-13,21,24,27-33H2,1-8H3,(H,57,72)(H,58,68)(H,59,73)(H,61,71)(H,62,70) | LTSUOBBLDXXDGS-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 20682.8357172317 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | N-acyl-alpha amino acids and derivatives | 0.54 | 459839 | 58 | 58 | LTSUOBBLDXXDGS | <Binary: 256 bytes> | 734 | <Binary: 256 bytes> | 101 | |||
| 59 | 59 | 59 | CCMSLIB00000001605 | [M+H]1+ | isolated | Apratoxin B | 826.0 | 825.4710351040001 | 1 | positive | CCC(C)C1NC(=O)C(C)N(C)C(=O)C(Cc2ccc(OC)cc2)=NC(=O)C(C)CC2CSC(=N2)C(C)C(O)CC(C)CC(C(C)(C)C)OC(=O)C2CCCN2C1=O | InChI=1S/C44H67N5O8S/c1-12-26(3)37-42(54)49-19-13-14-34(49)43(55)57-36(44(7,8)9)21-25(2)20-35(50)28(5)40-45-31(24-58-40)22-27(4)38(51)46-33(23-30-15-17-32(56-11)18-16-30)41(53)48(10)29(6)39(52)47-37/h15-18,25-29,31,34-37,50H,12-14,19-24H2,1-11H3,(H,47,52) | SGICJVIWOBUOOI-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 578.7382389204896 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.97 | 442341 | 59 | 59 | SGICJVIWOBUOOI | <Binary: 256 bytes> | 780 | <Binary: 256 bytes> | 98 | |||
| 60 | 60 | 60 | CCMSLIB00000001606 | [M+H]1+ | isolated | Emericellamide A | 610.416 | 609.4101491 | 1 | positive | CCCCCCC(C)C1OC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)CNC(=O)C1C | InChI=1S/C31H55N5O7/c1-10-11-12-13-14-19(6)26-20(7)27(38)32-16-24(37)36-25(18(4)5)30(41)35-23(15-17(2)3)29(40)33-21(8)28(39)34-22(9)31(42)43-26/h17-23,25-26H,10-16H2,1-9H3,(H,32,38)(H,33,40)(H,34,39)(H,35,41)(H,36,37) | QURRTAYEASAREY-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.339739224201534 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.84 | 400768 | 60 | 60 | QURRTAYEASAREY | <Binary: 256 bytes> | 478 | <Binary: 256 bytes> | 59 | |||
| 61 | 61 | 61 | CCMSLIB00000001607 | [M+Na]1+ | isolated | Emericellamide A | 632.398 | 609.4101491 | 1 | positive | CCCCCCC(C)C1OC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)CNC(=O)C1C | InChI=1S/C31H55N5O7/c1-10-11-12-13-14-19(6)26-20(7)27(38)32-16-24(37)36-25(18(4)5)30(41)35-23(15-17(2)3)29(40)33-21(8)28(39)34-22(9)31(42)43-26/h17-23,25-26H,10-16H2,1-9H3,(H,32,38)(H,33,40)(H,34,39)(H,35,41)(H,36,37) | QURRTAYEASAREY-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.1702512048284546 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.84 | 408572 | 61 | 61 | QURRTAYEASAREY | <Binary: 256 bytes> | 478 | <Binary: 256 bytes> | 59 | |||
| 62 | 62 | 62 | CCMSLIB00000001608 | [M+Na]1+ | isolated | Apratoxin B | 848.0 | 825.4710351040001 | 1 | positive | CCC(C)C1NC(=O)C(C)N(C)C(=O)C(Cc2ccc(OC)cc2)=NC(=O)C(C)CC2CSC(=N2)C(C)C(O)CC(C)CC(C(C)(C)C)OC(=O)C2CCCN2C1=O | InChI=1S/C44H67N5O8S/c1-12-26(3)37-42(54)49-19-13-14-34(49)43(55)57-36(44(7,8)9)21-25(2)20-35(50)28(5)40-45-31(24-58-40)22-27(4)38(51)46-33(23-30-15-17-32(56-11)18-16-30)41(53)48(10)29(6)39(52)47-37/h15-18,25-29,31,34-37,50H,12-14,19-24H2,1-11H3,(H,47,52) | SGICJVIWOBUOOI-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 542.4636538930569 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.97 | 445169 | 62 | 62 | SGICJVIWOBUOOI | <Binary: 256 bytes> | 780 | <Binary: 256 bytes> | 98 | |||
| 63 | 63 | 63 | CCMSLIB00000001609 | [M+H]1+ | isolated | Cyanosporaside B | 440.088 | 417.0979150399999 | 1 | positive | CC1OC(OC23C(=Cc4c(Cl)cc(CC#N)cc42)C=CC3O)C(=O)C(O)C1(C)O | InChI=1S/C21H20ClNO6/c1-10-20(2,27)18(26)17(25)19(28-10)29-21-12(3-4-16(21)24)9-13-14(21)7-11(5-6-23)8-15(13)22/h3-4,7-10,16,18-19,24,26-27H,5H2,1-2H3 | ULXZDYCUENKUCJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 52577.22069504858 | Organic compounds | Benzenoids | Indenes and isoindenes | Indenes and isoindenes | 1.43 | 299607 | 63 | 63 | ULXZDYCUENKUCJ | <Binary: 256 bytes> | 670 | <Binary: 256 bytes> | 60 | ||||
| 64 | 64 | 64 | CCMSLIB00000001610 | [M+Na]1+ | isolated | hydrated Cyanosporaside B | 458.098 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 316932 | 64 | 64 | |||||||||||||||||||
| 65 | 65 | 65 | CCMSLIB00000001611 | [M+H]1+ | isolated | Salinisporazine A | 398.244 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 257308 | 65 | 65 | |||||||||||||||||||
| 66 | 66 | 66 | CCMSLIB00000001612 | [M+Na]1+ | isolated | Salinisporazine A | 420.226 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 279884 | 66 | 66 | |||||||||||||||||||
| 67 | 67 | 67 | CCMSLIB00000001613 | [M+H]1+ | isolated | Cyclomarin D | 995.598 | 1012.59974076 | 1 | positive | C=CC(C)(C)n1cc(C(O)C2NC(=O)C(C(C)C=C(C)C)NC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(C(OC)c3ccccc3)NC(=O)C(C)NC(=O)C(CC(C)CO)NC2=O)c2ccccc21 | InChI=1S/C55H80N8O10/c1-15-55(11,12)63-28-38(37-23-19-20-24-40(37)63)46(65)44-52(70)57-39(27-33(8)29-64)49(67)56-35(10)48(66)61-45(47(73-14)36-21-17-16-18-22-36)53(71)58-42(32(6)7)54(72)62(13)41(26-31(4)5)50(68)59-43(51(69)60-44)34(9)25-30(2)3/h15-25,28,31-35,39,41-47,64-65H,1,26-27,29H2,2-14H3,(H,56,67)(H,57,70)(H,58,71)(H,59,68)(H,60,69)(H,61,66) | AHDUXXXZGSWYHF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 17767.261519139476 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.07 | 457379 | 67 | 67 | AHDUXXXZGSWYHF | <Binary: 256 bytes> | 844 | <Binary: 256 bytes> | 94 | |||
| 68 | 68 | 68 | CCMSLIB00000001614 | [M+H]1+ | isolated | Cyclomarin D | 1035.59 | 1012.59974076 | 1 | positive | C=CC(C)(C)n1cc(C(O)C2NC(=O)C(C(C)C=C(C)C)NC(=O)C(CC(C)C)N(C)C(=O)C(C(C)C)NC(=O)C(C(OC)c3ccccc3)NC(=O)C(C)NC(=O)C(CC(C)CO)NC2=O)c2ccccc21 | InChI=1S/C55H80N8O10/c1-15-55(11,12)63-28-38(37-23-19-20-24-40(37)63)46(65)44-52(70)57-39(27-33(8)29-64)49(67)56-35(10)48(66)61-45(47(73-14)36-21-17-16-18-22-36)53(71)58-42(32(6)7)54(72)62(13)41(26-31(4)5)50(68)59-43(51(69)60-44)34(9)25-30(2)3/h15-25,28,31-35,39,41-47,64-65H,1,26-27,29H2,2-14H3,(H,56,67)(H,57,70)(H,58,71)(H,59,68)(H,60,69)(H,61,66) | AHDUXXXZGSWYHF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 21687.871654417057 | Organic compounds | Organic acids and derivatives | Carboxylic acids and derivatives | Amino acids, peptides, and analogues | Cyclic peptides | 1.07 | 458382 | 68 | 68 | AHDUXXXZGSWYHF | <Binary: 256 bytes> | 844 | <Binary: 256 bytes> | 94 | |||
| 69 | 69 | 69 | CCMSLIB00000001615 | [M+H]1+ | isolated | Pacificanone A | 323.258 | 322.250794948 | 1 | positive | CCC1CC(C)C(O)(C=CC(C)=CC(C)C(O)CC)C(C)C1=O | InChI=1S/C20H34O3/c1-7-17-12-15(5)20(23,16(6)19(17)22)10-9-13(3)11-14(4)18(21)8-2/h9-11,14-18,21,23H,7-8,12H2,1-6H3 | JSPPQWVTDRBUIB-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.2244135760268885 | Organic compounds | Lipids and lipid-like molecules | Fatty Acyls | Fatty alcohols | Fatty alcohols | 2.06 | 154901 | 69 | 69 | JSPPQWVTDRBUIB | <Binary: 256 bytes> | 342 | <Binary: 256 bytes> | 45 | |||
| 70 | 70 | 70 | CCMSLIB00000001616 | [M+Na]1+ | isolated | Pacificanone A | 345.24 | 322.250794948 | 1 | positive | CCC1CC(C)C(O)(C=CC(C)=CC(C)C(O)CC)C(C)C1=O | InChI=1S/C20H34O3/c1-7-17-12-15(5)20(23,16(6)19(17)22)10-9-13(3)11-14(4)18(21)8-2/h9-11,14-18,21,23H,7-8,12H2,1-6H3 | JSPPQWVTDRBUIB-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.0486368881201148 | Organic compounds | Lipids and lipid-like molecules | Fatty Acyls | Fatty alcohols | Fatty alcohols | 2.06 | 193122 | 70 | 70 | JSPPQWVTDRBUIB | <Binary: 256 bytes> | 342 | <Binary: 256 bytes> | 45 | |||
| 71 | 71 | 71 | CCMSLIB00000001617 | [M+H]1+ | isolated | Piperazimycin A | 727.32 | 726.310367384 | 1 | positive | CC(C)C=CC=CCC1NC(=O)C2CC(O)CNN2C(=O)COC(=O)C(C)(CO)NC(=O)C2CC(O)CNN2C(=O)C2CC(Cl)CNN2C1=O | InChI=1S/C31H47ClN8O10/c1-17(2)7-5-4-6-8-21-28(47)40-24(9-18(32)12-33-40)29(48)39-23(11-20(43)14-35-39)27(46)37-31(3,16-41)30(49)50-15-25(44)38-22(26(45)36-21)10-19(42)13-34-38/h4-7,17-24,33-35,41-43H,8-16H2,1-3H3,(H,36,45)(H,37,46) | OHBCWVJHZZYAHJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 3.237978916502562 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.94 | 427184 | 71 | 71 | OHBCWVJHZZYAHJ | <Binary: 256 bytes> | 714 | <Binary: 256 bytes> | 72 | |||
| 72 | 72 | 72 | CCMSLIB00000001618 | [M+Na]1+ | isolated | Piperazimycin A | 749.288 | 726.310367384 | 1 | positive | CC(C)C=CC=CCC1NC(=O)C2CC(O)CNN2C(=O)COC(=O)C(C)(CO)NC(=O)C2CC(O)CNN2C(=O)C2CC(Cl)CNN2C1=O | InChI=1S/C31H47ClN8O10/c1-17(2)7-5-4-6-8-21-28(47)40-24(9-18(32)12-33-40)29(48)39-23(11-20(43)14-35-39)27(46)37-31(3,16-41)30(49)50-15-25(44)38-22(26(45)36-21)10-19(42)13-34-38/h4-7,17-24,33-35,41-43H,8-16H2,1-3H3,(H,36,45)(H,37,46) | OHBCWVJHZZYAHJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 15.46672234565194 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.94 | 430757 | 72 | 72 | OHBCWVJHZZYAHJ | <Binary: 256 bytes> | 714 | <Binary: 256 bytes> | 72 | |||
| 73 | 73 | 73 | CCMSLIB00000001619 | [M+H]1+ | isolated | Actinoquinolone A | 404.131 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 263243 | 73 | 73 | |||||||||||||||||||
| 74 | 74 | 74 | CCMSLIB00000001620 | [M+Na]1+ | isolated | Actinoquinolone A | 426.202 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 285149 | 74 | 74 | |||||||||||||||||||
| 75 | 75 | 75 | CCMSLIB00000001621 | [M+H]1+ | isolated | Desferrioxamine E | 601.358 | 600.348277116 | 1 | positive | O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1 | InChI=1S/C27H48N6O9/c34-22-10-14-26(38)32(41)20-8-3-6-18-30-24(36)12-15-27(39)33(42)21-9-2-5-17-29-23(35)11-13-25(37)31(40)19-7-1-4-16-28-22/h40-42H,1-21H2,(H,28,34)(H,29,35)(H,30,36) | NHKCCADZVLTPPO-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 4.062500248867478 | Organic compounds | Phenylpropanoids and polyketides | Macrolactams | Macrolactams | 0.12 | 397597 | 75 | 75 | NHKCCADZVLTPPO | <Binary: 256 bytes> | 351 | <Binary: 256 bytes> | 26 | ||||
| 76 | 76 | 76 | CCMSLIB00000001622 | [M+Na]1+ | isolated | Desferrioxamine E | 623.339 | 600.348277116 | 1 | positive | O=C1CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN1 | InChI=1S/C27H48N6O9/c34-22-10-14-26(38)32(41)20-8-3-6-18-30-24(36)12-15-27(39)33(42)21-9-2-5-17-29-23(35)11-13-25(37)31(40)19-7-1-4-16-28-22/h40-42H,1-21H2,(H,28,34)(H,29,35)(H,30,36) | NHKCCADZVLTPPO-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.4044104469992105 | Organic compounds | Phenylpropanoids and polyketides | Macrolactams | Macrolactams | 0.12 | 405304 | 76 | 76 | NHKCCADZVLTPPO | <Binary: 256 bytes> | 351 | <Binary: 256 bytes> | 26 | ||||
| 77 | 77 | 77 | CCMSLIB00000001623 | [M+H]1+ | isolated | Marineosin A | 410.282 | 409.27292736 | 1 | positive | COC1CC(c2ccc[nH]2)=NC12OC(C)CC1CCCCCCCc3ccc([nH]3)C12 | InChI=1S/C25H35N3O2/c1-17-15-18-9-6-4-3-5-7-10-19-12-13-21(27-19)24(18)25(30-17)23(29-2)16-22(28-25)20-11-8-14-26-20/h8,11-14,17-18,23-24,26-27H,3-7,9-10,15-16H2,1-2H3 | JPTGQNMDWMSVSF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 4.37609316742372 | Organic compounds | Organoheterocyclic compounds | Oxanes | Oxanes | 0.51 | 269445 | 77 | 77 | JPTGQNMDWMSVSF | <Binary: 256 bytes> | 700 | <Binary: 256 bytes> | 60 | ||||
| 78 | 78 | 78 | CCMSLIB00000001624 | [M+Na]1+ | isolated | Marineosin A | 432.264 | 409.27292736 | 1 | positive | COC1CC(c2ccc[nH]2)=NC12OC(C)CC1CCCCCCCc3ccc([nH]3)C12 | InChI=1S/C25H35N3O2/c1-17-15-18-9-6-4-3-5-7-10-19-12-13-21(27-19)24(18)25(30-17)23(29-2)16-22(28-25)20-11-8-14-26-20/h8,11-14,17-18,23-24,26-27H,3-7,9-10,15-16H2,1-2H3 | JPTGQNMDWMSVSF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 4.282532035329737 | Organic compounds | Organoheterocyclic compounds | Oxanes | Oxanes | 0.51 | 291431 | 78 | 78 | JPTGQNMDWMSVSF | <Binary: 256 bytes> | 700 | <Binary: 256 bytes> | 60 | ||||
| 79 | 79 | 79 | CCMSLIB00000001625 | [M+H]1+ | isolated | Marineosin B | 410.282 | 409.27292736 | 1 | positive | COC1CC(c2ccc[nH]2)=NC12OC(C)CC1CCCCCCCc3ccc([nH]3)C12 | InChI=1S/C25H35N3O2/c1-17-15-18-9-6-4-3-5-7-10-19-12-13-21(27-19)24(18)25(30-17)23(29-2)16-22(28-25)20-11-8-14-26-20/h8,11-14,17-18,23-24,26-27H,3-7,9-10,15-16H2,1-2H3 | JPTGQNMDWMSVSF-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 4.37609316742372 | Organic compounds | Organoheterocyclic compounds | Oxanes | Oxanes | 0.51 | 269446 | 79 | 79 | JPTGQNMDWMSVSF | <Binary: 256 bytes> | 700 | <Binary: 256 bytes> | 60 | ||||
| 80 | 80 | 80 | CCMSLIB00000001626 | [M+2Na]2+ | isolated | Lyngbyabellin A | 736.0 | 690.17154698 | 2 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 999592.5132380188 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 464931 | 80 | 80 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 81 | 81 | 81 | CCMSLIB00000001627 | [M+H]1+ | isolated | Sagitol B (Putative Analogue) | 419.155 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 279360 | 81 | 81 | |||||||||||||||||||
| 82 | 82 | 82 | CCMSLIB00000001628 | [M+H]1+ | isolated | Lyngbyabellin A | 738.0 | 690.17154698 | 1 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 67741.0502984344 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 428751 | 82 | 82 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 83 | 83 | 83 | CCMSLIB00000001629 | [M+Na]1+ | isolated | Sagitol B (Putative Analogue) | 441.137 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 301025 | 83 | 83 | |||||||||||||||||||
| 84 | 84 | 84 | CCMSLIB00000001630 | [M+H]1+ | isolated | Lyngbyabellin A | 693.0 | 690.17154698 | 1 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2634.888694871331 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 421779 | 84 | 84 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 85 | 85 | 85 | CCMSLIB00000001631 | [M+H]1+ | isolated | Etamycin | 879.461 | 878.453804804 | 1 | positive | CC(C)CC1NC(=O)C(NC(=O)c2ncccc2O)C(C)OC(=O)C(c2ccccc2)N(C)C(=O)C(C)NC(=O)C(C(C)C(C)C)N(C)C(=O)CN(C)C(=O)C2CC(O)CN2C1=O | InChI=1S/C44H62N8O11/c1-23(2)19-30-42(60)52-21-29(53)20-31(52)43(61)49(8)22-33(55)50(9)36(25(5)24(3)4)40(58)46-26(6)41(59)51(10)37(28-15-12-11-13-16-28)44(62)63-27(7)34(38(56)47-30)48-39(57)35-32(54)17-14-18-45-35/h11-18,23-27,29-31,34,36-37,53-54H,19-22H2,1-10H3,(H,46,58)(H,47,56)(H,48,57) | SATIISJKSAELDC-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.0971530195405934 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.59 | 448548 | 85 | 85 | SATIISJKSAELDC | <Binary: 256 bytes> | 807 | <Binary: 256 bytes> | 94 | |||
| 86 | 86 | 86 | CCMSLIB00000001632 | [M+H]1+ | isolated | Lyngbyabellin A | 715.0 | 690.17154698 | 1 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 34464.56770105772 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 425122 | 86 | 86 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 87 | 87 | 87 | CCMSLIB00000001633 | [M+Na]1+ | isolated | Etamycin | 901.443 | 878.453804804 | 1 | positive | CC(C)CC1NC(=O)C(NC(=O)c2ncccc2O)C(C)OC(=O)C(c2ccccc2)N(C)C(=O)C(C)NC(=O)C(C(C)C(C)C)N(C)C(=O)CN(C)C(=O)C2CC(O)CN2C1=O | InChI=1S/C44H62N8O11/c1-23(2)19-30-42(60)52-21-29(53)20-31(52)43(61)49(8)22-33(55)50(9)36(25(5)24(3)4)40(58)46-26(6)41(59)51(10)37(28-15-12-11-13-16-28)44(62)63-27(7)34(38(56)47-30)48-39(57)35-32(54)17-14-18-45-35/h11-18,23-27,29-31,34,36-37,53-54H,19-22H2,1-10H3,(H,46,58)(H,47,56)(H,48,57) | SATIISJKSAELDC-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.0329363021474038 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 0.59 | 450601 | 87 | 87 | SATIISJKSAELDC | <Binary: 256 bytes> | 807 | <Binary: 256 bytes> | 94 | |||
| 88 | 88 | 88 | CCMSLIB00000001634 | [M+H]1+ | isolated | Lyngbyabellin A | 691.0 | 690.17154698 | 1 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 258.7184875092499 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 421498 | 88 | 88 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 89 | 89 | 89 | CCMSLIB00000001635 | [M+H]1+ | isolated | Rifamycin W | 656.306 | 655.2992612600001 | 1 | positive | C=C1C=C(CO)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)=CC=CC(C)C(=O)Nc2cc(O)c3c(c(O)c(C)c(O)c3c2O)C1=O | InChI=1S/C35H45NO11/c1-14-9-8-10-15(2)35(47)36-22-12-23(38)24-25(32(44)20(7)33(45)26(24)34(22)46)28(40)16(3)11-21(13-37)31(43)19(6)30(42)18(5)29(41)17(4)27(14)39/h8-12,15,17-19,27,29-31,37-39,41-46H,3,13H2,1-2,4-7H3,(H,36,47) | PJJBEUPFNRRJRL-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.8256760605066484 | Organic compounds | Phenylpropanoids and polyketides | Macrolactams | Macrolactams | 1.62 | 415023 | 89 | 89 | PJJBEUPFNRRJRL | <Binary: 256 bytes> | 757 | <Binary: 256 bytes> | 65 | ||||
| 90 | 90 | 90 | CCMSLIB00000001636 | [M+Na]1+ | isolated | Lyngbyabellin A | 713.0 | 690.17154698 | 1 | positive | CCC(C)C1NC(=O)CNC(=O)c2csc(n2)C(C(C)(C)O)OC(=O)C(C)(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 | InChI=1S/C29H40Cl2N4O7S2/c1-8-15(2)20-23-34-17(14-43-23)25(38)41-18(10-9-11-29(7,30)31)27(3,4)26(39)42-21(28(5,6)40)24-33-16(13-44-24)22(37)32-12-19(36)35-20/h13-15,18,20-21,40H,8-12H2,1-7H3,(H,32,37)(H,35,36) | VJSNPXXBMRWPEJ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 225.42601176738003 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.89 | 424902 | 90 | 90 | VJSNPXXBMRWPEJ | <Binary: 256 bytes> | 680 | <Binary: 256 bytes> | 74 | |||
| 91 | 91 | 91 | CCMSLIB00000001637 | [M+Na]1+ | isolated | Rifamycin W | 678.29 | 655.2992612600001 | 1 | positive | C=C1C=C(CO)C(O)C(C)C(O)C(C)C(O)C(C)C(O)C(C)=CC=CC(C)C(=O)Nc2cc(O)c3c(c(O)c(C)c(O)c3c2O)C1=O | InChI=1S/C35H45NO11/c1-14-9-8-10-15(2)35(47)36-22-12-23(38)24-25(32(44)20(7)33(45)26(24)34(22)46)28(40)16(3)11-21(13-37)31(43)19(6)30(42)18(5)29(41)17(4)27(14)39/h8-12,15,17-19,27,29-31,37-39,41-46H,3,13H2,1-2,4-7H3,(H,36,47) | PJJBEUPFNRRJRL-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 2.2318755673868336 | Organic compounds | Phenylpropanoids and polyketides | Macrolactams | Macrolactams | 1.62 | 419086 | 91 | 91 | PJJBEUPFNRRJRL | <Binary: 256 bytes> | 757 | <Binary: 256 bytes> | 65 | ||||
| 92 | 92 | 92 | CCMSLIB00000001638 | [M+H]1+ | isolated | Antanapeptin A | 737.4 | 736.44111488 | 1 | positive | C#CCCCC1OC(=O)C(C(C)CC)N(C)C(=O)C2CCCN2C(=O)C(C(C)C)OC(=O)C(Cc2ccccc2)N(C)C(=O)C(C(C)C)NC(=O)C1C | InChI=1S/C41H60N4O8/c1-11-13-15-22-32-28(8)36(46)42-33(25(3)4)38(48)43(9)31(24-29-19-16-14-17-20-29)40(50)53-35(26(5)6)39(49)45-23-18-21-30(45)37(47)44(10)34(27(7)12-2)41(51)52-32/h1,14,16-17,19-20,25-28,30-35H,12-13,15,18,21-24H2,2-10H3,(H,42,46) | HEWGADDUUGVTPF-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 65.62408769072962 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.42 | 428727 | 92 | 92 | HEWGADDUUGVTPF | <Binary: 256 bytes> | 661 | <Binary: 256 bytes> | 82 | |||
| 93 | 93 | 93 | CCMSLIB00000001639 | [M+H]1+ | isolated | 8-Desoxyrifamycin W | 640.312 | 1 | positive | qtof | ESI | GNPS-LIBRARY | 411119 | 93 | 93 | |||||||||||||||||||
| 94 | 94 | 94 | CCMSLIB00000001640 | [M+Na]1+ | isolated | Antanapeptin A | 759.23 | 736.44111488 | 1 | positive | C#CCCCC1OC(=O)C(C(C)CC)N(C)C(=O)C2CCCN2C(=O)C(C(C)C)OC(=O)C(Cc2ccccc2)N(C)C(=O)C(C(C)C)NC(=O)C1C | InChI=1S/C41H60N4O8/c1-11-13-15-22-32-28(8)36(46)42-33(25(3)4)38(48)43(9)31(24-29-19-16-14-17-20-29)40(50)53-35(26(5)6)39(49)45-23-18-21-30(45)37(47)44(10)34(27(7)12-2)41(51)52-32/h1,14,16-17,19-20,25-28,30-35H,12-13,15,18,21-24H2,2-10H3,(H,42,46) | HEWGADDUUGVTPF-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 263.8011886153219 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.42 | 432045 | 94 | 94 | HEWGADDUUGVTPF | <Binary: 256 bytes> | 661 | <Binary: 256 bytes> | 82 | |||
| 95 | 95 | 95 | CCMSLIB00000001641 | [M+H]1+ | isolated | Saliniketal A | 396.274 | 395.267173284 | 1 | positive | CC(=CC=CC(C)C(N)=O)C(O)C(C)C(O)C(C)C1OC2(C)CCC(O2)C1C | InChI=1S/C22H37NO5/c1-12(8-7-9-13(2)21(23)26)18(24)15(4)19(25)16(5)20-14(3)17-10-11-22(6,27-17)28-20/h7-9,13-20,24-25H,10-11H2,1-6H3,(H2,23,26) | ZCCRXBYKWLDBSD-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 1.139714655353392 | Organic compounds | Lipids and lipid-like molecules | Prenol lipids | Sesquiterpenoids | Sesquiterpenoids | 2.57 | 255325 | 95 | 95 | ZCCRXBYKWLDBSD | <Binary: 256 bytes> | 441 | <Binary: 256 bytes> | 52 | |||
| 96 | 96 | 96 | CCMSLIB00000001642 | [M+H]1+ | isolated | Antanapeptin B | 739.21 | 738.456764944 | 1 | positive | C=CCCCC1OC(=O)C(C(C)CC)N(C)C(=O)C2CCCN2C(=O)C(C(C)C)OC(=O)C(Cc2ccccc2)N(C)C(=O)C(C(C)C)NC(=O)C1C | InChI=1S/C41H62N4O8/c1-11-13-15-22-32-28(8)36(46)42-33(25(3)4)38(48)43(9)31(24-29-19-16-14-17-20-29)40(50)53-35(26(5)6)39(49)45-23-18-21-30(45)37(47)44(10)34(27(7)12-2)41(51)52-32/h11,14,16-17,19-20,25-28,30-35H,1,12-13,15,18,21-24H2,2-10H3,(H,42,46) | LZACOZXZESEOFK-UHFFFAOYSA-N | ion trap | ESI | GNPS-LIBRARY | 343.5521229319907 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.54 | 428910 | 96 | 96 | LZACOZXZESEOFK | <Binary: 256 bytes> | 660 | <Binary: 256 bytes> | 82 | |||
| 97 | 97 | 97 | CCMSLIB00000001643 | [M+Na]1+ | isolated | Saliniketal A | 418.256 | 395.267173284 | 1 | positive | CC(=CC=CC(C)C(N)=O)C(O)C(C)C(O)C(C)C1OC2(C)CCC(O2)C1C | InChI=1S/C22H37NO5/c1-12(8-7-9-13(2)21(23)26)18(24)15(4)19(25)16(5)20-14(3)17-10-11-22(6,27-17)28-20/h7-9,13-20,24-25H,10-11H2,1-6H3,(H2,23,26) | ZCCRXBYKWLDBSD-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.9465191781897504 | Organic compounds | Lipids and lipid-like molecules | Prenol lipids | Sesquiterpenoids | Sesquiterpenoids | 2.57 | 278022 | 97 | 97 | ZCCRXBYKWLDBSD | <Binary: 256 bytes> | 441 | <Binary: 256 bytes> | 52 | |||
| 98 | 98 | 98 | CCMSLIB00000001644 | [M+H]1+ | isolated | Dolastatin_10 | 785.23 | 784.492104896 | 1 | positive | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(Cc1ccccc1)c1nccs1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C)C(C)C | InChI=1S/C42H68N6O6S/c1-13-28(6)37(47(10)42(52)35(26(2)3)45-40(51)36(27(4)5)46(8)9)33(53-11)25-34(49)48-22-17-20-32(48)38(54-12)29(7)39(50)44-31(41-43-21-23-55-41)24-30-18-15-14-16-19-30/h14-16,18-19,21,23,26-29,31-33,35-38H,13,17,20,22,24-25H2,1-12H3,(H,44,50)(H,45,51) | OFDNQWIFNXBECV-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 342.9457005464546 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Hybrid peptides | Hybrid peptides | 0.32 | 435775 | 98 | 98 | OFDNQWIFNXBECV | <Binary: 256 bytes> | 630 | <Binary: 256 bytes> | 89 | |||
| 99 | 99 | 99 | CCMSLIB00000001645 | [M+H]1+ | isolated | Enterocin | 445.113 | 444.1056468399999 | 1 | positive | COc1cc(C2C3(O)C(O)C4CC2(O)C(O)(C(=O)O4)C3C(=O)c2ccccc2)oc(=O)c1 | InChI=1S/C22H20O10/c1-30-11-7-12(31-14(23)8-11)16-20(27)9-13-18(25)21(16,28)17(22(20,29)19(26)32-13)15(24)10-5-3-2-4-6-10/h2-8,13,16-18,25,27-29H,9H2,1H3 | CTBBEXWJRAPJIZ-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 0.1637919179349871 | Organic compounds | Organic oxygen compounds | Organooxygen compounds | Carbonyl compounds | Alkyl-phenylketones | 1.32 | 304143 | 99 | 99 | CTBBEXWJRAPJIZ | <Binary: 256 bytes> | 776 | <Binary: 256 bytes> | 56 | |||
| 100 | 100 | 100 | CCMSLIB00000001646 | [M+H]1+ | isolated | Dolastatin_12 | 969.29 | 968.59465538 | 1 | positive | CCC(C)C1OC(=O)C(C)C(CC)NC(=O)C(C)N(C)C(=O)C(C)(C)C(=O)C(C)NC(=O)C(Cc2ccccc2)N(C)C(=O)C(C(C)C)N(C)C(=O)CNC(=O)C(CC(C)C)N(C)C(=O)CNC1=O | InChI=1S/C50H80N8O11/c1-17-30(7)41-46(65)52-26-38(59)56(14)36(24-28(3)4)44(63)51-27-39(60)58(16)40(29(5)6)47(66)57(15)37(25-34-22-20-19-21-23-34)45(64)53-32(9)42(61)50(11,12)49(68)55(13)33(10)43(62)54-35(18-2)31(8)48(67)69-41/h19-23,28-33,35-37,40-41H,17-18,24-27H2,1-16H3,(H,51,63)(H,52,65)(H,53,64)(H,54,62) | MLDFWFKDAWCBSV-UHFFFAOYSA-N | qtof | ESI | GNPS-LIBRARY | 321.7155499713646 | Organic compounds | Organic acids and derivatives | Peptidomimetics | Depsipeptides | Cyclic depsipeptides | 1.15 | 455758 | 100 | 100 | MLDFWFKDAWCBSV | <Binary: 256 bytes> | 799 | <Binary: 256 bytes> | 85 |
Advanced export
JSON shape: default, array, newline-delimited
CREATE TABLE "library_table" ( "scan" INTEGER, "spectrum_id" TEXT, "collision_energy" REAL, "Adduct" TEXT, "Compound_Source" TEXT, "Compound_Name" TEXT, "Precursor_MZ" REAL, "ExactMass" REAL, "Charge" INTEGER, "Ion_Mode" TEXT, "Smiles" TEXT, "INCHI" TEXT, "InChIKey_smiles" TEXT, "msManufacturer" TEXT, "msMassAnalyzer" TEXT, "msIonisation" TEXT, "msDissociationMethod" TEXT, "GNPS_library_membership" TEXT, "ppmBetweenExpAndThMass" REAL, "classyfire_kingdom" TEXT, "classyfire_superclass" TEXT, "classyfire_class" TEXT, "classyfire_subclass" TEXT, "classyfire_direct_parent" TEXT, "np_classifier_nplikeness" REAL, "falcon_cluster" INTEGER, "spectrum_id_int" INTEGER, "representative_spectrum_int" INTEGER, "InChIKey_smiles_firstBlock" TEXT , fp_pattern BLOB, fp_popcnt INTEGER, fp_morgan BLOB, fp_morgan_popcnt INTEGER); CREATE INDEX idx_lt__spectrum_id_int ON library_table(spectrum_id_int); CREATE INDEX idx_lt__spectrum_id ON library_table(spectrum_id); CREATE INDEX idx_lt__representative_spectrum_int ON library_table(representative_spectrum_int);